Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A994 | Purity: >98% |
 | |
| Chemical structure of GSK2292767 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1254036-66-2 |
|---|---|
| Purity | >98% |
| Formula | C24H28N6O5S |
| Mol Weight | 512.581 |
| CoA | CoA of GSK2292767 |
| Smiles: | COC1=NC=C(C=C1NS(C)(=O)=O)C1=CC2=C(C=NN2)C(=C1)C1=NC=C(CN2C[C@H](C)O[C@H](C)C2)O1 |
|---|
KEYWORDS: buy GSK2292767 | GSK2292767 supplier | purchase | cost | manufacturer | order | distributor | buy 1254036-66-2 | 1254036-66-2 supplier