Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9906 | Purity: >98% |
 | |
| Chemical structure of HMOM-TPHAP |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | HMOM-TPHAP-GB |
|---|---|
| CAS No. | 672926-26-0 |
| Purity | >98% |
| Formula | C32H42O9 |
| Mol Weight | 570.6705 |
| CoA | CoA of HMOM-TPHAP |
| Smiles: | OC=1C(=CC(=CC1COC)C(C=2C=C(C(O)=C(C2)COC)COC)(C=3C=C(C(O)=C(C3)COC)COC)C)COC |
|---|
KEYWORDS: buy HMOM-TPHAP | HMOM-TPHAP supplier | purchase | cost | manufacturer | order | distributor | buy 672926-26-0 | 672926-26-0 supplier