Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9315 | Purity: >98% |
 | |
| Chemical structure of SRX3177 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2241237-51-2 |
|---|---|
| Purity | >98% |
| Formula | C31H32N6O4S |
| Mol Weight | 584.689 |
| CoA | CoA of SRX3177 |
| Smiles: | O=C1C=C(N2CCOCC2)OC3=C1SC=C3C4=CC=C(NC5=NC6=C(C=C(N6C7CCCC7)C(N(C)C)=O)C=N5)C=C4 |
|---|
KEYWORDS: buy SRX3177 | SRX3177 supplier | purchase | cost | manufacturer | order | distributor | buy 2241237-51-2 | 2241237-51-2 supplier