Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A900 | Purity: >98% |
 | |
| Chemical structure of HLCL-61 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 586395-74-6 |
|---|---|
| Purity | >98% |
| Formula | C23H24N2O |
| Mol Weight | 344.4495 |
| CoA | CoA of HLCL-61 |
| Smiles: | CCN1C2=C(C=CC=C2)C2=C1C=CC(CNCC1=CC=CC=C1OC)=C2 |
|---|
KEYWORDS: buy HLCL-61 | HLCL-61 supplier | purchase | cost | manufacturer | order | distributor | buy 586395-74-6 | 586395-74-6 supplier