Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A879 | Purity: >98% |
 | |
| Chemical structure of HM-61713 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | BI-1482694 |
|---|---|
| Synonyms 2 | Olmutinib |
| CAS No. | 1353550-13-6 |
| Purity | >98% |
| Formula | C26H26N6O2S |
| Mol Weight | 486.589 |
| CoA | CoA of HM-61713 |
| Smiles: | CN1CCN(CC1)C1=CC=C(NC2=NC(OC3=CC(NC(=O)C=C)=CC=C3)=C3SC=CC3=N2)C=C1 |
|---|
KEYWORDS: buy HM-61713 | HM-61713 supplier | purchase | cost | manufacturer | order | distributor | buy 1353550-13-6 | 1353550-13-6 supplier