Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A784 | Purity: >98% |
 | |
| Chemical structure of MSX122 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 897657-95-3 |
|---|---|
| Purity | >98% |
| Formula | C16H16N6 |
| Mol Weight | 292.3384 |
| CoA | CoA of MSX122 |
| Smiles: | C(NC1=NC=CC=N1)C1=CC=C(CNC2=NC=CC=N2)C=C1 |
|---|
KEYWORDS: buy MSX122 | MSX122 supplier | purchase | cost | manufacturer | order | distributor | buy 897657-95-3 | 897657-95-3 supplier