Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A712 | Purity: >98% |
 | |
| Chemical structure of JNJ-31020028 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1094873-17-2 |
|---|---|
| Purity | >98% |
| Formula | C34H36FN5O2 |
| Mol Weight | 565.6803 |
| CoA | CoA of JNJ-31020028 |
| Smiles: | CCN(CC)C(=O)C(N1CCN(CC1)C1=CC=C(NC(=O)C2=CC=CC=C2C2=CC=CN=C2)C=C1F)C1=CC=CC=C1 |
|---|
KEYWORDS: buy JNJ-31020028 | JNJ-31020028 supplier | purchase | cost | manufacturer | order | distributor | buy 1094873-17-2 | 1094873-17-2 supplier