Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A635 | Purity: >98% |
 | |
| Chemical structure of JZL-195 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1210004-12-8 |
|---|---|
| Purity | >98% |
| Formula | C24H23N3O5 |
| Mol Weight | 433.4565 |
| CoA | CoA of JZL-195 |
| Smiles: | [O-][N+](=O)C1=CC=C(OC(=O)N2CCN(CC3=CC(OC4=CC=CC=C4)=CC=C3)CC2)C=C1 |
|---|
KEYWORDS: buy JZL-195 | JZL-195 supplier | purchase | cost | manufacturer | order | distributor | buy 1210004-12-8 | 1210004-12-8 supplier