Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A604 | Purity: >98% |
 | |
| Chemical structure of FLT3-IN-2 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 923562-23-6 |
|---|---|
| Purity | >98% |
| Formula | C21H16ClF3N4 |
| Mol Weight | 416.827 |
| CoA | CoA of FLT3-IN-2 |
| Smiles: | FC(F)(F)C1=CC=C(CNC2=NC=C(CC3=CNC4=NC=C(Cl)C=C34)C=C2)C=C1 |
|---|
KEYWORDS: buy FLT3-IN-2 | FLT3-IN-2 supplier | purchase | cost | manufacturer | order | distributor | buy 923562-23-6 | 923562-23-6 supplier