Product Information:
| Cat. No.: EX-A4963A | Purity: >98% |
![]() | |
| Chemical structure of Mps1-IN-3 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2989453-29-2 |
|---|---|
| Purity | >98% |
| Formula | C26H32ClN7O4S |
| Mol Weight | 574.095 |
| Reference: | |
| CoA | CoA of Mps1-IN-3 hydrochloride |
| Smiles: | OC1CCN(C2=CC=C(NC3=NC(NC4=CC=CC=C4S(=O)(C(C)C)=O)=C5N=CNC5=N3)C(OC)=C2)CC1.[H]Cl |
|---|
KEYWORDS: buy Mps1-IN-3 hydrochloride | Mps1-IN-3 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 2989453-29-2 | 2989453-29-2 supplier


Inhibitor Specialist
