Boc-Dap-NE
|
|
|
| Cat. No.: EX-A4186 | Purity: >98% |
|  |
| Chemical structure of Boc-Dap-NE |
For research only, Do not use for Human!
| CAS No. | 160800-65-7 |
|---|
| Purity | >98% |
|---|
| Formula | C23H36N2O5 |
|---|
| Mol Weight | 420.5423 |
|---|
| Appearance | solid powder |
|---|
| Solubility | Soluble in DMSO |
|---|
| Shelf Life | >2 years if stored properly |
|---|
| Storage | Powder -20℃ 2 years; In solvent -20℃ 1 month; |
|---|
| Shipping | Shipped under ambient temperature as non-hazardous chemical. This product is stable enough for a few weeks during ordinary shipping and time spent in Customs. |
|---|
| |
|---|
| | |
|---|
| CoA | CoA of Boc-Dap-NE |
|---|
| Smiles: | O=C(N1[C@@H](CCC1)[C@@H]([C@@H](C)C(N[C@H](C)[C@@H](O)C2=CC=CC=C2)=O)OC)OC(C)(C)C |
|---|
KEYWORDS: buy Boc-Dap-NE | Boc-Dap-NE supplier | purchase | cost | manufacturer | order | distributor | buy 160800-65-7 | 160800-65-7 supplier
Inhibitor Specialist 