Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A402 | Purity: >98% |
 | |
| Chemical structure of Lapatinib |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 231277-92-2 |
|---|---|
| Purity | >98% |
| Formula | C29H26ClFN4O4S |
| Mol Weight | 581.058 |
| CoA | CoA of Lapatinib |
| Smiles: | CS(=O)(=O)CCNCC1=CC=C(O1)C1=CC2=C(NC3=CC=C(OCC4=CC=CC(F)=C4)C(Cl)=C3)N=CN=C2C=C1 |
|---|
KEYWORDS: buy Lapatinib | Lapatinib supplier | purchase | cost | manufacturer | order | distributor | buy 231277-92-2 | 231277-92-2 supplier