Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A340 | Purity: >98% |
 | |
| Chemical structure of GSK 2606414 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1337531-36-8 |
|---|---|
| Purity | >98% |
| Formula | C24H20F3N5O |
| Mol Weight | 451.4437 |
| CoA | CoA of GSK 2606414 |
| Smiles: | CN1C=C(C2=C(N)N=CN=C12)C1=CC2=C(C=C1)N(CC2)C(=O)CC1=CC=CC(=C1)C(F)(F)F |
|---|
KEYWORDS: buy GSK 2606414 | GSK 2606414 supplier | purchase | cost | manufacturer | order | distributor | buy 1337531-36-8 | 1337531-36-8 supplier