Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2883A | Purity: >98% |
 | |
| Chemical structure of 3-Deazaneplanocin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 102052-95-9 |
|---|---|
| Purity | >98% |
| Formula | C12H14N4O3 |
| Mol Weight | 262.2646 |
| CoA | CoA of 3-Deazaneplanocin |
| Smiles: | C1=CN=C(C2=C1N(C=N2)[C@@H]3C=C([C@H]([C@H]3O)O)CO)N |
|---|
KEYWORDS: buy 3-Deazaneplanocin | 3-Deazaneplanocin supplier | purchase | cost | manufacturer | order | distributor | buy 102052-95-9 | 102052-95-9 supplier