Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A273 | Purity: >98% |
 | |
| Chemical structure of ML-161 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 423735-93-7 |
|---|---|
| Purity | >98% |
| Formula | C17H17BrN2O2 |
| Mol Weight | 361.233 |
| CoA | CoA of ML-161 |
| Smiles: | CCCC(=O)NC1=CC(NC(=O)C2=CC=CC=C2Br)=CC=C1 |
|---|
KEYWORDS: buy ML-161 | ML-161 supplier | purchase | cost | manufacturer | order | distributor | buy 423735-93-7 | 423735-93-7 supplier