Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2559 | Purity: >98% |
 | |
| Chemical structure of JPH203 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1037592-40-7 |
|---|---|
| Purity | >98% |
| Formula | C23H19Cl2N3O4 |
| Mol Weight | 472.321 |
| CoA | CoA of JPH203 |
| Smiles: | N[C@@H](CC1=CC(Cl)=C(OCC2=CC(N)=CC3=C2OC(=N3)C2=CC=CC=C2)C(Cl)=C1)C(O)=O |
|---|
KEYWORDS: buy JPH203 | JPH203 supplier | purchase | cost | manufacturer | order | distributor | buy 1037592-40-7 | 1037592-40-7 supplier