Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2542 | Purity: >98% |
 | |
| Chemical structure of Dp44mT |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 152095-12-0 |
|---|---|
| Purity | >98% |
| Formula | C14H15N5S |
| Mol Weight | 285.367 |
| CoA | CoA of Dp44mT |
| Smiles: | CN(C)C(=S)N\N=C(/C1=NC=CC=C1)C1=NC=CC=C1 |
|---|
KEYWORDS: buy Dp44mT | Dp44mT supplier | purchase | cost | manufacturer | order | distributor | buy 152095-12-0 | 152095-12-0 supplier