Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1558 | Purity: >98% |
 | |
| Chemical structure of GNE-317 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1394076-92-6 |
|---|---|
| Purity | >98% |
| Formula | C19H22N6O3S |
| Mol Weight | 414.481 |
| CoA | CoA of GNE-317 |
| Smiles: | COC1(COC1)C1=C(C)C2=NC(=NC(N3CCOCC3)=C2S1)C1=CN=C(N)N=C1 |
|---|
KEYWORDS: buy GNE-317 | GNE-317 supplier | purchase | cost | manufacturer | order | distributor | buy 1394076-92-6 | 1394076-92-6 supplier