Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A153 | Purity: >98% |
 | |
| Chemical structure of LY315920 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 172732-68-2 |
|---|---|
| Purity | >98% |
| Formula | C21H20N2O5 |
| Mol Weight | 380.3939 |
| CoA | CoA of LY315920 |
| Smiles: | CCC1=C(C(=O)C(N)=O)C2=C(C=CC=C2OCC(O)=O)N1CC1=CC=CC=C1 |
|---|
KEYWORDS: buy LY315920 | LY315920 supplier | purchase | cost | manufacturer | order | distributor | buy 172732-68-2 | 172732-68-2 supplier