Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1458 | Purity: >98% |
 | |
| Chemical structure of Cyantraniliprole |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 736994-63-1 |
|---|---|
| Purity | >98% |
| Formula | C19H14BrClN6O2 |
| Mol Weight | 473.71 |
| CoA | CoA of Cyantraniliprole |
| Smiles: | CNC(=O)C1=C(NC(=O)C2=CC(Br)=NN2C2=C(Cl)C=CC=N2)C(C)=CC(=C1)C#N |
|---|
KEYWORDS: buy Cyantraniliprole | Cyantraniliprole supplier | purchase | cost | manufacturer | order | distributor | buy 736994-63-1 | 736994-63-1 supplier