Product Information:
| Cat. No.: EX-A14489 | Purity: >98% |
![]() | |
| Chemical structure of 6-Bnz-cAMP sodium salt |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1135306-29-4 |
|---|---|
| Purity | >98% |
| Formula | C17H15N5NaO7P |
| Mol Weight | 455.2938 |
| Reference: | |
| CoA | CoA of 6-Bnz-cAMP sodium salt |
| Smiles: | C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C(N=CN=C43)NC(=O)C5=CC=CC=C5)O)OP(=O)(O1)[O-].[Na+] |
|---|
KEYWORDS: buy 6-Bnz-cAMP sodium salt | 6-Bnz-cAMP sodium salt supplier | purchase | cost | manufacturer | order | distributor | buy 1135306-29-4 | 1135306-29-4 supplier


Inhibitor Specialist
