Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1371 | Purity: >98% |
 | |
| Chemical structure of Emedastine |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 87233-61-2 |
|---|---|
| Purity | >98% |
| Formula | C17H26N4O |
| Mol Weight | 302.4145 |
| CoA | CoA of Emedastine |
| Smiles: | CCOCCN1C2=CC=CC=C2N=C1N1CCCN(C)CC1 |
|---|
KEYWORDS: buy Emedastine | Emedastine supplier | purchase | cost | manufacturer | order | distributor | buy 87233-61-2 | 87233-61-2 supplier