Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1337 | Purity: >99% |
 | |
| Chemical structure of Doxorubicin hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Adriamycin |
|---|---|
| CAS No. | 25316-40-9 |
| Purity | >99% |
| Formula | C27H30ClNO11 |
| Mol Weight | 579.98 |
| CoA | CoA of Doxorubicin hydrochloride |
| Smiles: | Cl.[H][C@@]1(C[C@H](N)[C@H](O)[C@H](C)O1)O[C@H]1C[C@@](O)(CC2=C(O)C3=C(C(=O)C4=C(OC)C=CC=C4C3=O)C(O)=C12)C(=O)CO |
|---|
KEYWORDS: buy Doxorubicin hydrochloride | Doxorubicin hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 25316-40-9 | 25316-40-9 supplier