Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1286 | Purity: >98% |
 | |
| Chemical structure of Debio 0617B |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1332329-27-7 |
|---|---|
| Purity | >98% |
| Formula | C28H23ClF3N7O2 |
| Mol Weight | 581.976 |
| CoA | CoA of Debio 0617B |
| Smiles: | CNC(=O)C1=CC=C(NC2=NC3=C(CN(CC3)C3=CC(NC(=O)C4=NC=CC(=C4)C(F)(F)F)=CC=C3Cl)C=N2)C=C1 |
|---|
KEYWORDS: buy Debio 0617B | Debio 0617B supplier | purchase | cost | manufacturer | order | distributor | buy 1332329-27-7 | 1332329-27-7 supplier