Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1255 | Purity: >98% |
 | |
| Chemical structure of Fosaprepitant dimeglumine |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 265121-04-8 |
|---|---|
| Purity | >98% |
| Formula | C37H56F7N6O16P |
| Mol Weight | 1004.8337 |
| CoA | CoA of Fosaprepitant dimeglumine |
| Smiles: | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.C[C@@H](O[C@H]1OCCN(CC2=NC(=O)N(N2)P(O)(O)=O)[C@H]1C1=CC=C(F)C=C1)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
|---|
KEYWORDS: buy Fosaprepitant dimeglumine | Fosaprepitant dimeglumine supplier | purchase | cost | manufacturer | order | distributor | buy 265121-04-8 | 265121-04-8 supplier