Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1206 | Purity: >99% |
 | |
| Chemical structure of Docetaxel |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 114977-28-5 |
|---|---|
| Purity | >99% |
| Formula | C43H53NO14 |
| Mol Weight | 807.8792 |
| CoA | CoA of Docetaxel |
| Smiles: | CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@]1(C)[C@@H]2[C@H](OC(=O)C2=CC=CC=C2)[C@]2(O)C[C@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C3=CC=CC=C3)C(C)=C([C@@H](O)C1=O)C2(C)C |
|---|
KEYWORDS: buy Docetaxel | Docetaxel supplier | purchase | cost | manufacturer | order | distributor | buy 114977-28-5 | 114977-28-5 supplier