Product Information:
| Cat. No.: EX-A11912 | Purity: >98% |
![]() | |
| Chemical structure of WEE1-IN-10 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2226938-19-6 |
|---|---|
| Purity | >98% |
| Formula | C28H30Cl2N8O |
| Mol Weight | 565.497 |
| Appearance | solid |
| Solubility | Soluble in DMSO |
| Shelf Life | >3 years if stored properly |
| Storage | Powder 4℃, 2 years; In solvent -20℃ 1 month; |
| Shipping | Shipped under ambient temperature as non-hazardous chemical. This product is stable enough for a few weeks during ordinary shipping and time spent in Customs. |
| Reference: | |
| CoA | CoA of WEE1-IN-10 |
| Smiles: | C[C@@H]1CN(C[C@@H](N1C)C)C2=C(C=C(C=C2)NC3=NC=C4C(=N3)N5CCN=C5N(C4=O)C6=C(C=CC=C6Cl)Cl)C |
|---|
KEYWORDS: buy WEE1-IN-10 | WEE1-IN-10 supplier | purchase | cost | manufacturer | order | distributor | buy 2226938-19-6 | 2226938-19-6 supplier


Inhibitor Specialist
