Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11864 | Purity: >98% |
 | |
| Chemical structure of LY 341495 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 201943-63-7 |
|---|---|
| Purity | >98% |
| Formula | C20H19NO5 |
| Mol Weight | 353.3686 |
| CoA | CoA of LY 341495 |
| Smiles: | C1[C@@H]([C@H]1[C@@](CC2C3=CC=CC=C3OC4=CC=CC=C24)(C(=O)O)N)C(=O)O |
|---|
KEYWORDS: buy LY 341495 | LY 341495 supplier | purchase | cost | manufacturer | order | distributor | buy 201943-63-7 | 201943-63-7 supplier