Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1148 | Purity: >98% |
 | |
| Chemical structure of Idarubicin hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 57852-57-0 |
|---|---|
| Purity | >98% |
| Formula | C26H28ClNO9 |
| Mol Weight | 533.955 |
| CoA | CoA of Idarubicin hydrochloride |
| Smiles: | Cl.[H][C@@]1(C[C@H](N)[C@H](O)[C@H](C)O1)O[C@H]1C[C@@](O)(CC2=C1C(O)=C1C(=O)C3=C(C=CC=C3)C(=O)C1=C2O)C(C)=O |
|---|
KEYWORDS: buy Idarubicin hydrochloride | Idarubicin hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 57852-57-0 | 57852-57-0 supplier