Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11467 | Purity: >98% |
 | |
| Chemical structure of DT204 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 428497-71-6 |
|---|---|
| Purity | >98% |
| Formula | C19H13BrClNO5S |
| Mol Weight | 482.732 |
| CoA | CoA of DT204 |
| Smiles: | O=C(O)COC1=CC=C(Br)C=C1C=C2SC(=O)N(C2=O)CC3=CC=C(Cl)C=C3 |
|---|
KEYWORDS: buy DT204 | DT204 supplier | purchase | cost | manufacturer | order | distributor | buy 428497-71-6 | 428497-71-6 supplier