Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1089 | Purity: >99% |
 | |
| Chemical structure of Ledipasvir acetone |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1441674-54-9 |
|---|---|
| Purity | >99% |
| Formula | C52H60F2N8O7 |
| Mol Weight | 947.079 |
| CoA | CoA of Ledipasvir acetone |
| Smiles: | CC(C)=O.COC(=O)N[C@@H](C(C)C)C(=O)N1CC2(CC2)C[C@H]1C1=NC=C(N1)C1=CC2=C(C=C1)C1=C(C=C(C=C1)C1=CC3=C(C=C1)N=C(N3)[C@@H]1[C@H]3CC[C@H](C3)N1C(=O)[C@@H](NC(=O)OC)C(C)C)C2(F)F |
|---|
KEYWORDS: buy Ledipasvir acetone | Ledipasvir acetone supplier | purchase | cost | manufacturer | order | distributor | buy 1441674-54-9 | 1441674-54-9 supplier