Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10351 | Purity: >98% |
 | |
| Chemical structure of TDI-11861 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2857049-72-8 |
|---|---|
| Purity | >98% |
| Formula | C22H25ClF2N6O3 |
| Mol Weight | 494.922 |
| CoA | CoA of TDI-11861 |
| Smiles: | NC1=NC(C2=NN(C=C2CC3=C(C=CC=C3)OCCN4CCOC[C@H]4CO)C(F)F)=CC(Cl)=N1 |
|---|
KEYWORDS: buy TDI-11861 | TDI-11861 supplier | purchase | cost | manufacturer | order | distributor | buy 2857049-72-8 | 2857049-72-8 supplier