Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10294 | Purity: >98% |
 | |
| Chemical structure of BMH-22 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 309726-06-5 |
|---|---|
| Purity | >98% |
| Formula | C16H17N3 |
| Mol Weight | 251.3263 |
| CoA | CoA of BMH-22 |
| Smiles: | CC1=C2N=C3N=C(C=C(C3=C(C2=CC(C)=C1)N)C)C |
|---|
KEYWORDS: buy BMH-22 | BMH-22 supplier | purchase | cost | manufacturer | order | distributor | buy 309726-06-5 | 309726-06-5 supplier