Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10121 | Purity: |
 | |
| Chemical structure of ofirnoflast |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Ofirnoflastum |
|---|---|
| CAS No. | 2731294-23-6 |
| Formula | C23H19F4N7O2 |
| Mol Weight | 501.4363 |
| CoA | CoA of ofirnoflast |
| Smiles: | O=C(NC1=NOC(=C1)C2(CC2)C(F)(F)F)NC=3C=CC(=CC3F)C4=CN(C=5N=CN=C(N)C54)C6CC6 |
|---|
KEYWORDS: buy ofirnoflast | ofirnoflast supplier | purchase | cost | manufacturer | order | distributor | buy 2731294-23-6 | 2731294-23-6 supplier