Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10020 | Purity: >98% |
 | |
| Chemical structure of 177Lu-Satoreotide tetraxetan |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1934243-21-6 |
|---|---|
| Purity | >98% |
| Formula | C74H95ClLuN19O21S2 |
| Mol Weight | 1861.211 |
| CoA | CoA of 177Lu-Satoreotide tetraxetan |
| Smiles: | N([C@@H](CC1=CC=C(Cl)C=C1)C(N[C@H]2C(=O)N[C@@](CC3=CC=C(NC(=O)[C@@H]4CC(=O)NC(=O)N4)C=C3)(C(=O)N[C@H](CC5=CC=C(NC(N)=O)C=C5)C(=O)N[C@@H](CCCCN)C(=O)N[C@@]([C@@H](C)O)(C(=O)N[C@H](C(N[C@H](CC6=CC=C(O)C=C6)C(N)=O)=O)CSSC2)[H])[H])=O)C7=O[Lu+3]89%10%11%12%13 |
|---|
KEYWORDS: buy 177Lu-Satoreotide tetraxetan | 177Lu-Satoreotide tetraxetan supplier | purchase | cost | manufacturer | order | distributor | buy 1934243-21-6 | 1934243-21-6 supplier