Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A071 | Purity: >98% |
 | |
| Chemical structure of LY2109761 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 700874-71-1 |
|---|---|
| Purity | >98% |
| Formula | C26H27N5O2 |
| Mol Weight | 441.5249 |
| CoA | CoA of LY2109761 |
| Smiles: | C(CN1CCOCC1)OC1=CC=C2C(=C1)N=CC=C2C1=C2CCCN2N=C1C1=NC=CC=C1 |
|---|
KEYWORDS: buy LY2109761 | LY2109761 supplier | purchase | cost | manufacturer | order | distributor | buy 700874-71-1 | 700874-71-1 supplier