Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A064 | Purity: 99%+ |
 | |
| Chemical structure of Erlotinib hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 183319-69-9 |
|---|---|
| Purity | 99%+ |
| Formula | C22H24ClN3O4 |
| Mol Weight | 429.897 |
| CoA | CoA of Erlotinib hydrochloride |
| Smiles: | Cl.COCCOC1=CC2=NC=NC(NC3=CC=CC(=C3)C#C)=C2C=C1OCCOC |
|---|
KEYWORDS: buy Erlotinib hydrochloride | Erlotinib hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 183319-69-9 | 183319-69-9 supplier