Product Information:
| Cat. No.: EX-A8299 | Purity: >98% |
![]() | |
| Chemical structure of Arazasetron |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | SENS-401 |
|---|---|
| Synonyms 2 | (R)-Azasetron besylate |
| CAS No. | 2025360-91-0 |
| Purity | >98% |
| Formula | C23H26ClN3O6S |
| Mol Weight | 507.987 |
| Appearance | Solid powder |
| Shelf Life | >2 years if stored properly |
| Storage | Powder -20℃ 2 years; In solvent -20℃ 1 month; |
| Shipping | Shipped under ambient temperature as non-hazardous chemical. This product is stable enough for a few weeks during ordinary shipping and time spent in Customs. |
| Reference: | |
| CoA | CoA of Arazasetron |
| Smiles: | O=S(O)(C1=CC=CC=C1)=O.O=C(C2=C(OCC(N3C)=O)C3=CC(Cl)=C2)N[C@H]4CN5CCC4CC5 |
|---|
KEYWORDS: buy Arazasetron | Arazasetron supplier | purchase | cost | manufacturer | order | distributor | buy 2025360-91-0 | 2025360-91-0 supplier


Inhibitor Specialist
