Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A17100 | Purity: >98% |
 | |
| Chemical structure of ZMF-23 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3103822-31-4 |
|---|---|
| Purity | >98% |
| Formula | C22H23Cl2N5O3 |
| Mol Weight | 476.356 |
| CoA | CoA of ZMF-23 |
| Smiles: | O=C(NO)CCCCCN1C(=O)C(=CC=2C=NC(=NC21)NC3CC3)C4=CC=C(Cl)C=C4Cl |
|---|
KEYWORDS: buy ZMF-23 | ZMF-23 supplier | purchase | cost | manufacturer | order | distributor | buy 3103822-31-4 | 3103822-31-4 supplier