Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A136 | Purity: >98% |
 | |
| Chemical structure of ZM306416 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 690206-97-4 |
|---|---|
| Purity | >98% |
| Formula | C16H14Cl2FN3O2 |
| Mol Weight | 370.206 |
| CoA | CoA of ZM306416 |
| Smiles: | Cl.COC1=CC2=NC=NC(NC3=CC=C(Cl)C=C3F)=C2C=C1OC |
|---|
KEYWORDS: buy ZM306416 | ZM306416 supplier | purchase | cost | manufacturer | order | distributor | buy 690206-97-4 | 690206-97-4 supplier