Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3781 | Purity: >98% |
 | |
| Chemical structure of ZL0580 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2377151-10-3 |
|---|---|
| Purity | >98% |
| Formula | C25H23F3N4O4S |
| Mol Weight | 532.535 |
| CoA | CoA of ZL0580 |
| Smiles: | O=C(NC1=CC=C(S(N2CCC[C@H]2C(NC3=CC=CC=C3)=O)(=O)=O)C=C1)NC4=CC=C(C(F)(F)F)C=C4 |
|---|
KEYWORDS: buy ZL0580 | ZL0580 supplier | purchase | cost | manufacturer | order | distributor | buy 2377151-10-3 | 2377151-10-3 supplier