Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12056 | Purity: >98% |
 | |
| Chemical structure of ZINC37781618 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1183572-42-0 |
|---|---|
| Purity | >98% |
| Formula | C16H15ClN4 |
| Mol Weight | 298.77 |
| CoA | CoA of ZINC37781618 |
| Smiles: | ClC=1C=CC=CC1CNC2=CC=CC(=C2)C3=NN=C(N3)C |
|---|
KEYWORDS: buy ZINC37781618 | ZINC37781618 supplier | purchase | cost | manufacturer | order | distributor | buy 1183572-42-0 | 1183572-42-0 supplier