Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A14117 | Purity: >98% |
 | |
| Chemical structure of ZI88 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3077481-89-8 |
|---|---|
| Purity | >98% |
| Formula | C48H59N7O6S |
| Mol Weight | 862.09 |
| CoA | CoA of ZI88 |
| Smiles: | O=C1OCC(C)(C)CC=2C3=CC(=CC=C3N(C2C=4C=C(C#CCN5CCOCC5)C=NC4C(OC)C)CC)C=6N=C(SC6)CC(NC(=O)C7C(C)C7C)C(=O)N8NC1C9CC8C9 |
|---|
KEYWORDS: buy ZI88 | ZI88 supplier | purchase | cost | manufacturer | order | distributor | buy 3077481-89-8 | 3077481-89-8 supplier