Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13976 | Purity: >98% |
 | |
| Chemical structure of Zavegepant Impurity 12 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Zavegepant R-Isomer |
|---|---|
| CAS No. | 3019989-24-0 |
| Purity | >98% |
| Formula | C40H41N7O4 |
| Mol Weight | 683.798 |
| CoA | CoA of Zavegepant Impurity 12 |
| Smiles: | O=C1C(=CC=2C(N1)=CC=CC2)C3CCN(C([C@@H](CC=4C=C5C(=C(C)C4)NN=C5)NC(=O)N6CCC(CC6)C7=CC=8C(NC7=O)=CC=CC8)=O)CC3 |
|---|
KEYWORDS: buy Zavegepant Impurity 12 | Zavegepant Impurity 12 supplier | purchase | cost | manufacturer | order | distributor | buy 3019989-24-0 | 3019989-24-0 supplier