Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3847 | Purity: >98% |
 | |
| Chemical structure of Z-FF-FMK |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Cathepsin L Inhibitor I |
|---|---|
| CAS No. | 105608-85-3 |
| Purity | >98% |
| Formula | C27H27FN2O4 |
| Mol Weight | 462.5127 |
| CoA | CoA of Z-FF-FMK |
| Smiles: | C1=CC=C(C=C1)C[C@@H](C(=O)CF)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)OCC3=CC=CC=C3 |
|---|
KEYWORDS: buy Z-FF-FMK | Z-FF-FMK supplier | purchase | cost | manufacturer | order | distributor | buy 105608-85-3 | 105608-85-3 supplier