Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A693 | Purity: >98% |
 | |
| Chemical structure of YL-109 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 36341-25-0 |
|---|---|
| Purity | >98% |
| Formula | C14H11NO2S |
| Mol Weight | 257.308 |
| CoA | CoA of YL-109 |
| Smiles: | COC1=C/C(/C=CC1=O)=C1\NC2=CC=CC=C2S1 |
|---|
KEYWORDS: buy YL-109 | YL-109 supplier | purchase | cost | manufacturer | order | distributor | buy 36341-25-0 | 36341-25-0 supplier