Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A524 | Purity: >98% |
 | |
| Chemical structure of YK-4-279 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1037184-44-3 |
|---|---|
| Purity | >98% |
| Formula | C17H13Cl2NO4 |
| Mol Weight | 366.195 |
| CoA | CoA of YK-4-279 |
| Smiles: | COC1=CC=C(C=C1)C(=O)CC1(O)C(=O)NC2=C1C(Cl)=CC=C2Cl |
|---|
KEYWORDS: buy YK-4-279 | YK-4-279 supplier | purchase | cost | manufacturer | order | distributor | buy 1037184-44-3 | 1037184-44-3 supplier