Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2186 | Purity: >98% |
 | |
| Chemical structure of YH239-EE |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1364488-67-4 |
|---|---|
| Purity | >98% |
| Formula | C25H27Cl2N3O4 |
| Mol Weight | 504.406 |
| CoA | CoA of YH239-EE |
| Smiles: | CCOC(=O)C1=C(C(N(CC2=CC=C(Cl)C=C2)C=O)C(=O)NC(C)(C)C)C2=C(N1)C=C(Cl)C=C2 |
|---|
KEYWORDS: buy YH239-EE | YH239-EE supplier | purchase | cost | manufacturer | order | distributor | buy 1364488-67-4 | 1364488-67-4 supplier