Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16951 | Purity: >98% |
 | |
| Chemical structure of YG-004-07 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3077381-52-0 |
|---|---|
| Purity | >98% |
| Formula | C25H26BrClFN5O2 |
| Mol Weight | 562.862 |
| CoA | CoA of YG-004-07 |
| Smiles: | O=C1NC(=O)C(N2N=C(C=3C2=CC=CC3CCN4CCN(C=5C=C(Cl)C(Br)=CC5F)CC4)C)CC1 |
|---|
KEYWORDS: buy YG-004-07 | YG-004-07 supplier | purchase | cost | manufacturer | order | distributor | buy 3077381-52-0 | 3077381-52-0 supplier