Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13452Y | Purity: >98% |
 | |
| Chemical structure of YD-XB |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1313356-25-0 |
|---|---|
| Purity | >98% |
| Formula | C32H33N2O2 |
| Mol Weight | 477.6166 |
| CoA | CoA of YD-XB |
| Smiles: | O=C1C(C=C2N(C=3C=CC=CC3C2(C)C)CC=C)=C(O)C1=CC4=[N+](C=5C=CC=CC5C4(C)C)CC=C |
|---|
KEYWORDS: buy YD-XB | YD-XB supplier | purchase | cost | manufacturer | order | distributor | buy 1313356-25-0 | 1313356-25-0 supplier